Compound Q&A

What are the main uses of 3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid (CAS: 162401-62-9)?

Answer

3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid
3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid is primarily used as a pharmaceutical intermediate. It serves as a key component in the development of new drugs and the modification of existing drug molecules to improve their properties.

About

English Name 3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid
Molecular Formula C12H12F2O4
Molecular Weight 258.22 g/mol
SMILES c1cc(c(cc1C(=O)O)OCC2CC2)OC(F)F
InChIKey IGFDIFLMMLWKKY-UHFFFAOYSA-N
Last Updated: 2025-09-02 18:52

Related Q&A

Compound Q&A

What is 3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid (CAS: 162401-62-9)?

3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid is a chemical compound with the CAS number 16...

Compound Q&A

Is 3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid (CAS: 162401-62-9) safe?

3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid is safe when handled properly. It is not cons...

Compound Q&A

How should 3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid (CAS: 162401-62-9) be stored?

3-(Cyclopropylmethoxy)-4-(difluoromethoxy)benzoic acid should be stored in a cool, dry place, prefer...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...