Compound Q&A

What is N,N,N-Trimethyladamantan-1-aminium hydroxide (CAS: 53075-09-5)?

Answer

N,N,N-Trimethyladamantan-1-aminium hydroxide
N,N,N-Trimethyladamantan-1-aminium hydroxide is a quaternary ammonium compound with the formula (CH3)3N+adamantane-1-N-CH2-(-OH)2-. It is characterized by its unique adamantane structure and basic properties, making it suitable for various applications in chemistry and industry.

About

CAS No 53075-09-5
English Name N,N,N-Trimethyladamantan-1-aminium hydroxide
Molecular Formula C13H25NO
Molecular Weight 211.34 g/mol
SMILES C[N+](C)(C)C12CC3CC(C1)CC(C3)C2.[OH-]
InChIKey GNUJKXOGRSTACR-UHFFFAOYSA-M
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of N,N,N-Trimethyladamantan-1-aminium hydroxide (CAS: 53075-09-5)?

This compound is primarily used in surfactant applications, as a precipitating agent, and in the syn...

Compound Q&A

Is N,N,N-Trimethyladamantan-1-aminium hydroxide (CAS: 53075-09-5) safe?

N,N,N-Trimethyladamantan-1-aminium hydroxide is generally considered safe for industrial use. Howeve...

Compound Q&A

How should N,N,N-Trimethyladamantan-1-aminium hydroxide (CAS: 53075-09-5) be stored?

Store this compound in a cool, dry place, away from direct sunlight and heat sources. It should be k...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...