Compound Q&A

What are the main uses of (9E,11Z)-9,11-Octadecadienoic acid (CAS: 2420-56-6)?

Answer

(9E,11Z)-9,11-Octadecadienoic acid
(9E,11Z)-9,11-Octadecadienoic acid is primarily used in the food industry as a nutritional supplement due to its potential health benefits, such as improving body composition and supporting immune function. It is also utilized in the pharmaceutical industry for its potential anti-inflammatory and anti-cancer properties. Additionally, it has applications in cosmetics and research for studying lipid metabolism and fatty acid biology.

About

CAS No 2420-56-6
English Name (9E,11Z)-9,11-Octadecadienoic acid
Molecular Formula C18H32O2
Molecular Weight 280.45 g/mol
SMILES CCCCCC=CC=CCCCCCCCCC(=O)O
InChIKey JBYXPOFIGCOSSB-UQGDGPGGSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What is (9E,11Z)-9,11-Octadecadienoic acid (CAS: 2420-56-6)?

(9E,11Z)-9,11-Octadecadienoic acid, also known as conjugated linoleic acid (CLA), is a positional an...

Compound Q&A

Is (9E,11Z)-9,11-Octadecadienoic acid (CAS: 2420-56-6) safe?

While (9E,11Z)-9,11-Octadecadienoic acid is generally considered safe for human consumption, it is i...

Compound Q&A

How should (9E,11Z)-9,11-Octadecadienoic acid (CAS: 2420-56-6) be stored?

(9E,11Z)-9,11-Octadecadienoic acid should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...