Compound Q&A

How should (2R)-2-Amino-4-phenylbutanoic acid (CAS: 82795-51-5) be stored?

Answer

(2R)-2-Amino-4-phenylbutanoic acid
(2R)-2-Amino-4-phenylbutanoic acid should be stored in a cool, dry place away from direct sunlight and heat sources. Keep it in a tightly sealed container to prevent degradation and contamination. Avoid exposure to moisture and maintain a stable temperature range to ensure its long-term stability.

About

CAS No 82795-51-5
English Name (2R)-2-Amino-4-phenylbutanoic acid
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES C1=CC=C(C=C1)CCC(C(=O)O)N
InChIKey JTTHKOPSMAVJFE-SECBINFHSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What is (2R)-2-Amino-4-phenylbutanoic acid (CAS: 82795-51-5)?

(2R)-2-Amino-4-phenylbutanoic acid is a chiral amino acid derivative with a benzene ring substituent...

Compound Q&A

What are the main uses of (2R)-2-Amino-4-phenylbutanoic acid (CAS: 82795-51-5)?

(2R)-2-Amino-4-phenylbutanoic acid is primarily used as a precursor in the synthesis of drugs and ot...

Compound Q&A

Is (2R)-2-Amino-4-phenylbutanoic acid (CAS: 82795-51-5) safe?

(2R)-2-Amino-4-phenylbutanoic acid is generally considered safe for laboratory use, but proper handl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...