Compound Q&A

What is (2R,4R,4aS,6aS,6bR,8aR,11,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone (CAS: 8001-75-0)?

Answer

(2R,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone
This compound is a complex organic molecule with a unique structure, consisting of 20 carbon atoms and various functional groups such as hydroxyl and methylene. It is a member of the picene family of polycyclic aromatic hydrocarbons. Its chemical formula is C20H24O and it exhibits specific optical properties due to its stereochemistry.

About

CAS No 8001-75-0
English Name (2R,4R,4aS,6aS,6bR,8aR,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone
Molecular Formula C30H50O2
Molecular Weight 442.73 g/mol
SMILES CC1C(=O)C(CC2C1(CCC3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C)C)C)C)C)C)O
InChIKey DSEKYWAQQVUQTP-XEWMWGOFSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of (2R,4R,4aS,6aS,6bR,8aR,11,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone (CAS: 8001-75-0)?

This compound has potential applications in natural product chemistry and pharmaceutical research. I...

Compound Q&A

Is (2R,4R,4aS,6aS,6bR,8aR,11,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone (CAS: 8001-75-0) safe?

This compound is not generally considered toxic, but it should be handled with care. It is advisable...

Compound Q&A

How should (2R,4R,4aS,6aS,6bR,8aR,11,12aR,12bS,14aS,14bS)-2-Hydroxy-4,4a,6b,8a,11,11,12b,14a-octamethylicosahydro-3(2H)-picenone (CAS: 8001-75-0) be stored?

This compound should be stored at room temperature (15-25°C) in a cool, dry place, away from direct ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...