Compound Q&A

How should 3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid (CAS: 119736-16-2) be stored?

Answer

3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid
3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent exposure to air and light. The ideal storage temperature is between 15°C and 25°C. Avoid storing it in high humidity environments to prevent degradation.

About

English Name 3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid
Molecular Formula C13H10O5
Molecular Weight 246.22 g/mol
SMILES C1=CC=C(C=C1)COC2=C(OC=CC2=O)C(=O)O
InChIKey KJSJBKBZMGSIPT-UHFFFAOYSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What is 3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid (CAS: 119736-16-2)?

3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid is an organic compound with the molecular formula C13...

Compound Q&A

What are the main uses of 3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid (CAS: 119736-16-2)?

3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid is mainly used in pharmaceutical research and as an i...

Compound Q&A

Is 3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid (CAS: 119736-16-2) safe?

3-(Benzyloxy)-4-oxo-4h-pyran-2-carboxylic acid is generally considered safe for research use when ha...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...