Compound Q&A

What is 2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide hydrochloride (CAS: 101152-94-7)?

Answer

Cyclopropanecarboxamide, 2-(aminomethyl)-N,N-diethyl-1-phenyl-, hydrochloride (1:1), (1R,2S)-rel-
2-(Aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide hydrochloride (101152-94-7) is a complex organic compound with a molecular formula of C15H20N2O2·HCl. It is characterized by its cyclic structure and amide functionality, making it useful in various applications.

About

English Name Cyclopropanecarboxamide, 2-(aminomethyl)-N,N-diethyl-1-phenyl-, hydrochloride (1:1), (1R,2S)-rel-
Molecular Formula C15H23ClN2O
Molecular Weight 282.81 g/mol
SMILES CCN(CC)C(=O)C1(CC1CN)C2=CC=CC=C2.Cl
InChIKey XNCDYJFPRPDERF-PBCQUBLHSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of 2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide hydrochloride (CAS: 101152-94-7)?

This compound is primarily used in pharmaceuticals and research due to its unique chemical structure...

Compound Q&A

Is 2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide hydrochloride (CAS: 101152-94-7) safe?

This compound is generally considered safe when handled with appropriate precautions. Toxicology dat...

Compound Q&A

How should 2-(aminomethyl)-N,N-diethyl-1-phenylcyclopropanecarboxamide hydrochloride (CAS: 101152-94-7) be stored?

Store this compound in a cool, dry place, away from direct sunlight and heat sources. It should be k...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...