Compound Q&A

What is 4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone (CAS: 36978-41-3)?

Answer

4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone
4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone is a chemical compound with the CAS number 36978-41-3. It is a yellow solid with a molecular formula of C22H12O4. This compound is characterized by its aromatic structure and has properties such as solubility in organic solvents.

About

CAS No 36978-41-3
English Name 4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone
Molecular Formula C16H6O6
Molecular Weight 294.22 g/mol
SMILES C1=CC(=C2C(=C1)C(=O)OC2=O)C3=CC4=C(C=C3)C(=O)OC4=O
InChIKey FYYYKXFEKMGYLZ-UHFFFAOYSA-N
Last Updated: 2025-09-01 19:56

Related Q&A

Compound Q&A

What are the main uses of 4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone (CAS: 36978-41-3)?

4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone is primarily used in the synthesis of other organic compounds...

Compound Q&A

Is 4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone (CAS: 36978-41-3) safe?

4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone is generally considered safe under normal handling conditions...

Compound Q&A

How should 4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone (CAS: 36978-41-3) be stored?

4,5'-Bi-2-benzofuran-1,1',3,3'-tetrone should be stored in a tightly sealed container at room temper...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...