Compound Q&A

What are the main uses of Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) (CAS: 6054-98-4)?

Answer

Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate)
Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) is mainly used in pharmaceuticals for its potential anti-inflammatory and analgesic properties. It also finds applications in research, particularly in organic synthesis and as a precursor for other compounds. Additionally, it is used in some industrial applications, though on a smaller scale.

About

CAS No 6054-98-4
English Name Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate)
Molecular Formula C14H8N2Na2O6
Molecular Weight 346.2 g/mol
SMILES C1=CC(=C(C=C1N=NC2=CC(=C(C=C2)[O-])C(=O)O)C(=O)O)[O-].[Na+].[Na+]
InChIKey ZJEFYLVGGFISGT-VRZXRVJBSA-L
Last Updated: 2025-08-31 19:55

Related Q&A

Compound Q&A

What is Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) (CAS: 6054-98-4)?

Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) is a chemical compound with the CAS number...

Compound Q&A

Is Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) (CAS: 6054-98-4) safe?

Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) is generally considered safe for most appl...

Compound Q&A

How should Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) (CAS: 6054-98-4) be stored?

Disodium 3,3'-[(E)-1,2-diazenediyl]bis(6-hydroxybenzoate) should be stored in a cool, dry place, pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...