Compound Q&A

What is N,N-Diphenylaniline (CAS: 603-34-9)?

Answer

N,N-Diphenylaniline
N,N-Diphenylaniline is a chemical compound with the CAS number 603-34-9. It is a white-to-pale yellow solid with a molecular formula of C16H16N2 and a molecular weight of 232.31. This compound is used in various applications due to its properties such as being a phenolic amine, which makes it useful in the synthesis of other compounds, as a fungicide, and as an antioxidant.

About

CAS No 603-34-9
English Name N,N-Diphenylaniline
Molecular Formula C18H15N
Molecular Weight 245.33 g/mol
SMILES C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey ODHXBMXNKOYIBV-UHFFFAOYSA-N
Last Updated: 2025-08-31 19:55

Related Q&A

Compound Q&A

What are the main uses of N,N-Diphenylaniline (CAS: 603-34-9)?

N,N-Diphenylaniline is primarily used as a fungicide in agriculture to protect plants from fungal di...

Compound Q&A

Is N,N-Diphenylaniline (CAS: 603-34-9) safe?

N,N-Diphenylaniline is generally considered safe for industrial and agricultural use, but it is impo...

Compound Q&A

How should N,N-Diphenylaniline (CAS: 603-34-9) be stored?

N,N-Diphenylaniline should be stored in a cool, dry place away from direct sunlight and heat sources...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...