Compound Q&A

What is 6-Aminonaphthalene-2-sulfonic acid (CAS: 93-00-5)?

Answer

6-Aminonaphthalene-2-sulfonic acid
6-Aminonaphthalene-2-sulfonic acid (6-ANS, CAS: 93-00-5) is a fluorescent dye used in chemical and biological research. It has the chemical formula C10H7N2O3S. This compound is known for its ability to bind to proteins and is widely used in electrophoresis and as a protein stain.

About

CAS No 93-00-5
English Name 6-Aminonaphthalene-2-sulfonic acid
Molecular Formula C10H9NO3S
Molecular Weight 223.25 g/mol
SMILES C1=CC2=C(C=CC(=C2)S(=O)(=O)O)C=C1N
InChIKey SEMRCUIXRUXGJX-UHFFFAOYSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What are the main uses of 6-Aminonaphthalene-2-sulfonic acid (CAS: 93-00-5)?

6-Aminonaphthalene-2-sulfonic acid (6-ANS) is primarily used in research, particularly in electropho...

Compound Q&A

Is 6-Aminonaphthalene-2-sulfonic acid (CAS: 93-00-5) safe?

6-Aminonaphthalene-2-sulfonic acid (6-ANS) is generally considered safe for laboratory use. However,...

Compound Q&A

How should 6-Aminonaphthalene-2-sulfonic acid (CAS: 93-00-5) be stored?

6-Aminonaphthalene-2-sulfonic acid (6-ANS) should be stored in a cool, dry place away from direct su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...