Compound Q&A

What are the main uses of Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate (CAS: 888504-28-7)?

Answer

Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate
Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate is primarily used as a precursor in the synthesis of other organic compounds. It finds applications in pharmaceuticals, especially in the development of new drugs, and in industrial chemistry for various chemical transformations.

About

English Name Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate
Molecular Formula C4H3KN2O3
Molecular Weight 166.18 g/mol
SMILES CC1=NN=C(O1)C(=O)[O-].[K+]
InChIKey BRHMYHXNUGVBCU-UHFFFAOYSA-M
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate (CAS: 888504-28-7)?

Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate is an organic compound with the chemical formula K...

Compound Q&A

Is Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate (CAS: 888504-28-7) safe?

Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate is generally considered safe for handling when app...

Compound Q&A

How should Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate (CAS: 888504-28-7) be stored?

Potassium 5-methyl-1,3,4-oxadiazole-2-carboxylate should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...