Compound Q&A

What are the main uses of 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1898-66-4)?

Answer

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is primarily used as a reagent in analytical chemistry for the detection and identification of various compounds. It is also utilized in the synthesis of other compounds and in research related to organic chemistry and pharmaceutical development.

About

CAS No 1898-66-4
English Name 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine
Molecular Formula C18H13N5O6
Molecular Weight 394.32 g/mol
EINECS 217-591-8
SMILES c1ccc(cc1)N(c2ccccc2)Nc3c(cc(cc3[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-]
InChIKey WCBPJVKVIMMEQC-UHFFFAOYSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1898-66-4)?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine, also known as 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)h...

Compound Q&A

Is 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1898-66-4) safe?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine is not considered completely safe due to its chemical...

Compound Q&A

How should 1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine (CAS: 1898-66-4) be stored?

1,1-Diphenyl-2-(2,4,6-trinitrophenyl)hydrazine should be stored in a cool, dry place away from direc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...