Compound Q&A

Is Pseudolaric Acid B (CAS: 82508-31-4) safe?

Answer

Pseudolaric Acid B
Pseudolaric Acid B is generally considered safe when used as directed in pharmaceutical and cosmetic products. However, it is important to follow safety guidelines and avoid contact with eyes. Users should consult a healthcare professional before use.

About

CAS No 82508-31-4
English Name Pseudolaric Acid B
Molecular Formula C23H28O8
Molecular Weight 432.5 g/mol
SMILES CC(=CC=CC1(C2CCC3(C2(CCC(=CC3)C(=O)OC)OC(=O)C)C(=O)O1)C)C(=O)O
InChIKey VDGOFNMYZYBUDT-YDRCMHEVSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is Pseudolaric Acid B (CAS: 82508-31-4)?

Pseudolaric Acid B is a natural product isolated from the roots and rhizomes of the Chinese herbal p...

Compound Q&A

What are the main uses of Pseudolaric Acid B (CAS: 82508-31-4)?

Pseudolaric Acid B is primarily used in pharmaceuticals for its potential therapeutic effects in tre...

Compound Q&A

How should Pseudolaric Acid B (CAS: 82508-31-4) be stored?

Pseudolaric Acid B should be stored in a cool, dry place away from direct sunlight and heat. It shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...