Compound Q&A

What are the main uses of Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8)?

Answer

Benzyl L-leucinate 4-methylbenzenesulfonate (1:1)
Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) is primarily used in pharmaceutical research for its potential as a prodrug or as a carrier molecule. It also finds applications in the formulation of certain medications, where it can enhance drug delivery or stability.

About

CAS No 1738-77-8
English Name Benzyl L-leucinate 4-methylbenzenesulfonate (1:1)
Molecular Formula C20H27NO5S
Molecular Weight 393.51 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)CC(C(=O)OCC1=CC=CC=C1)N
InChIKey QTQGHKVYLQBJLO-YDALLXLXSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8)?

Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) is a derivative compound used in pharma...

Compound Q&A

Is Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) safe?

Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) is generally considered safe under norm...

Compound Q&A

How should Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) be stored?

Benzyl L-leucinate 4-methylbenzenesulfonate (CAS: 1738-77-8) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...