Compound Q&A

What are the main uses of 3-Biphenylylboronic acid (CAS: 5122-95-2)?

Answer

3-Biphenylylboronic acid
3-Biphenylylboronic acid is primarily used in the field of organic synthesis, particularly in Suzuki coupling reactions, where it serves as a boronic acid coupling partner. It is also used in the preparation of various organic compounds and as a reagent in medicinal chemistry.

About

CAS No 5122-95-2
English Name 3-Biphenylylboronic acid
Molecular Formula C12H11BO2
Molecular Weight 198.03 g/mol
SMILES B(C1=CC(=CC=C1)C2=CC=CC=C2)(O)O
InChIKey GOXICVKOZJFRMB-UHFFFAOYSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What is 3-Biphenylylboronic acid (CAS: 5122-95-2)?

3-Biphenylylboronic acid is a chemical compound with the chemical formula C21H16BO2. It is a boronic...

Compound Q&A

Is 3-Biphenylylboronic acid (CAS: 5122-95-2) safe?

3-Biphenylylboronic acid is generally considered safe for laboratory use when handled with appropria...

Compound Q&A

How should 3-Biphenylylboronic acid (CAS: 5122-95-2) be stored?

3-Biphenylylboronic acid should be stored in a sealed, airtight container at room temperature (15-25...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...