Compound Q&A

What is 5-Amino-2,4,6-triiodoisophthalic acid (CAS: 35453-19-1)?

Answer

5-Amino-2,4,6-triiodoisophthalic acid
5-Amino-2,4,6-triiodoisophthalic acid is a complex organic compound with the CAS number 35453-19-1. It has the chemical formula C8H3IN3O4 and is a derivative of isophthalic acid containing three iodine atoms and an amino group. It is characterized by its high iodine content and its ability to form complexes with other molecules.

About

CAS No 35453-19-1
English Name 5-Amino-2,4,6-triiodoisophthalic acid
Molecular Formula C8H4I3NO4
Molecular Weight 558.84 g/mol
SMILES C1(=C(C(=C(C(=C1I)N)I)C(=O)O)I)C(=O)O
InChIKey JEZJSNULLBSYHV-UHFFFAOYSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What are the main uses of 5-Amino-2,4,6-triiodoisophthalic acid (CAS: 35453-19-1)?

5-Amino-2,4,6-triiodoisophthalic acid is primarily used in the synthesis of other complex organic co...

Compound Q&A

Is 5-Amino-2,4,6-triiodoisophthalic acid (CAS: 35453-19-1) safe?

5-Amino-2,4,6-triiodoisophthalic acid is generally safe when handled with appropriate precautions. I...

Compound Q&A

How should 5-Amino-2,4,6-triiodoisophthalic acid (CAS: 35453-19-1) be stored?

5-Amino-2,4,6-triiodoisophthalic acid should be stored in a cool, dry place to maintain its stabilit...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...