Compound Q&A

What is 5-Methoxy-2-nitrobenzoic acid (CAS: 1882-69-5)?

Answer

5-Methoxy-2-nitrobenzoic acid
5-Methoxy-2-nitrobenzoic acid is a derivative of benzoic acid characterized by a 5-methoxy and 2-nitro substituent. Its chemical formula is C8H6NO3. This compound is commonly used in pharmaceuticals and research due to its analytical and synthesis applications.

About

CAS No 1882-69-5
English Name 5-Methoxy-2-nitrobenzoic acid
Molecular Formula C8H7NO5
Molecular Weight 197.14 g/mol
SMILES COC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O
InChIKey URADKXVAIGMTEG-UHFFFAOYSA-N
Last Updated: 2025-08-30 23:36

Related Q&A

Compound Q&A

What are the main uses of 5-Methoxy-2-nitrobenzoic acid (CAS: 1882-69-5)?

5-Methoxy-2-nitrobenzoic acid finds applications in analytical chemistry for derivatization and as a...

Compound Q&A

Is 5-Methoxy-2-nitrobenzoic acid (CAS: 1882-69-5) safe?

5-Methoxy-2-nitrobenzoic acid is generally safe when handled with proper precautions. It should be s...

Compound Q&A

How should 5-Methoxy-2-nitrobenzoic acid (CAS: 1882-69-5) be stored?

5-Methoxy-2-nitrobenzoic acid should be stored in a cool, dry, and well-ventilated area. Keep it awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...