Compound Q&A

What is 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9)?

Answer

1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene
1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene is an organic compound with the chemical formula C15H14ClI O. It contains a benzene ring with substituents including a chlorine atom, an iodine atom, and an ethoxybenzyl group. This compound is known for its complex structure and is used in various chemical applications. Its CAS number is 1103738-29-9.

About

English Name 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene
Molecular Formula C15H14ClIO
Molecular Weight 372.63 g/mol
SMILES CCOc1ccc(cc1)Cc1cc(I)ccc1Cl
InChIKey CZFRIPGHKLGMEU-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9)?

1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9) is primarily used in pharmaceutical re...

Compound Q&A

Is 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9) safe?

1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9) should be handled with care due to its...

Compound Q&A

How should 1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9) be stored?

1-Chloro-2-(4-ethoxybenzyl)-4-iodobenzene (CAS: 1103738-29-9) should be stored in a cool, dry, and d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...