Compound Q&A

What is Nickel(2+) bis(dibutylcarbamodithioate) (CAS: 13927-77-0)?

Answer

Nickel(2+) bis(dibutylcarbamodithioate)
Nickel(2+) bis(dibutylcarbamodithioate) is an organonickel compound with the chemical formula Ni(C4H9NS2)2. It is a yellow solid that is typically used as a catalyst in various chemical reactions. This compound exhibits moderate solubility in organic solvents and is known for its stability under normal conditions.

About

CAS No 13927-77-0
English Name Nickel(2+) bis(dibutylcarbamodithioate)
Molecular Formula C18H36N2NiS4
Molecular Weight 467.5 g/mol
SMILES CCCCN(CCCC)C(=S)[S-].CCCCN(CCCC)C(=S)[S-].[Ni+2]
InChIKey HPOWMHUJHHIQGP-UHFFFAOYSA-L
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What are the main uses of Nickel(2+) bis(dibutylcarbamodithioate) (CAS: 13927-77-0)?

Nickel(2+) bis(dibutylcarbamodithioate) is primarily used as a catalyst in organic synthesis, partic...

Compound Q&A

Is Nickel(2+) bis(dibutylcarbamodithioate) (CAS: 13927-77-0) safe?

Nickel(2+) bis(dibutylcarbamodithioate) is generally considered safe when handled properly. However,...

Compound Q&A

How should Nickel(2+) bis(dibutylcarbamodithioate) (CAS: 13927-77-0) be stored?

Nickel(2+) bis(dibutylcarbamodithioate) should be stored in a cool, dry, and well-ventilated area, a...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...