Compound Q&A

What are the main uses of 2-Phenylsuccinic acid (CAS: 635-51-8)?

Answer

2-Phenylsuccinic acid
2-Phenylsuccinic acid is primarily used in pharmaceuticals as a precursor for drug development, particularly in the synthesis of certain antibiotics and antifungal agents. It also finds applications in organic synthesis, polymer science, and as a reagent in chemical research due to its reactivity and functional groups.

About

CAS No 635-51-8
English Name 2-Phenylsuccinic acid
Molecular Formula C10H10O4
Molecular Weight 194.186 g/mol
SMILES C1=CC=C(C=C1)C(CC(=O)O)C(=O)O
InChIKey LVFFZQQWIZURIO-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is 2-Phenylsuccinic acid (CAS: 635-51-8)?

2-Phenylsuccinic acid, also known as 2-phenylsuccinic acid, is an organic compound with the chemical...

Compound Q&A

Is 2-Phenylsuccinic acid (CAS: 635-51-8) safe?

2-Phenylsuccinic acid is generally considered safe when handled properly, but it may cause skin and ...

Compound Q&A

How should 2-Phenylsuccinic acid (CAS: 635-51-8) be stored?

2-Phenylsuccinic acid should be stored in a cool, dry, and dark place, preferably at temperatures be...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...