Compound Q&A

What are the main uses of Dibenzo[b,d]furan-4-ylboronic acid (CAS: 100124-06-9)?

Answer

Dibenzo[b,d]furan-4-ylboronic acid
Dibenzo[b,d]furan-4-ylboronic acid is primarily used in pharmaceutical research for the development of new drugs. It serves as a key intermediate in the synthesis of bioactive molecules and is also utilized in industrial applications for chemical manufacturing. Additionally, it is employed in research related to organic chemistry and materials science due to its versatile reactivity and structural properties.

About

English Name Dibenzo[b,d]furan-4-ylboronic acid
Molecular Formula C12H9BO3
Molecular Weight 212.01 g/mol
SMILES B(C1=C2C(=CC=C1)C3=CC=CC=C3O2)(O)O
InChIKey ZXHUJRZYLRVVNP-UHFFFAOYSA-N
Last Updated: 2025-08-29 08:30

Related Q&A

Compound Q&A

What is Dibenzo[b,d]furan-4-ylboronic acid (CAS: 100124-06-9)?

Dibenzo[b,d]furan-4-ylboronic acid is a chemical compound with the CAS number 100124-06-9. It is cha...

Compound Q&A

Is Dibenzo[b,d]furan-4-ylboronic acid (CAS: 100124-06-9) safe?

Dibenzo[b,d]furan-4-ylboronic acid is generally considered safe when handled properly. However, it s...

Compound Q&A

How should Dibenzo[b,d]furan-4-ylboronic acid (CAS: 100124-06-9) be stored?

Dibenzo[b,d]furan-4-ylboronic acid should be stored in a cool, dry, and dark place to maintain its s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...