Compound Q&A

What is N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) (CAS: 219921-94-5)?

Answer

N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1)
N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) is a chemical compound with the CAS number 219921-94-5. It is a derivative of L-glutamic acid, featuring an acetyl group and a complex side chain containing a piperidine ring. This compound is known for its unique molecular structure and is often used in specialized chemical applications. Its chemical formula is C17H28N4O4, and it is typically a white to off-white solid with solubility in polar solvents.

About

English Name N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1)
Molecular Formula C23H37N3O5
Molecular Weight 435.57 g/mol
SMILES CC(C)CC(C1=CC=CC=C1N2CCCCC2)N.CC(=O)NC(CCC(=O)O)C(=O)O
InChIKey YPDMBMNFFPWTOV-NXMISADUSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What are the main uses of N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) (CAS: 219921-94-5)?

N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) is primarily...

Compound Q&A

Is N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) (CAS: 219921-94-5) safe?

N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) is generally...

Compound Q&A

How should N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) (CAS: 219921-94-5) be stored?

N-Acetyl-L-glutamic acid - (1S)-3-methyl-1-[2-(1-piperidinyl)phenyl]-1-butanamine (1:1) should be st...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...