Compound Q&A

What are the main uses of 2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5)?

Answer

2,4-Difluoro-1-nitrobenzene
2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) is primarily used in the pharmaceutical industry as a building block for synthesizing various drugs and agrochemicals. It also finds applications in organic research for functional group transformations and in industrial processes for the production of specialty chemicals. Its unique fluorine and nitro substituents make it valuable in creating compounds with specific biological and chemical properties.

About

CAS No 446-35-5
English Name 2,4-Difluoro-1-nitrobenzene
Molecular Formula C6H3F2NO2
Molecular Weight 159.09 g/mol
SMILES C1=CC(=C(C=C1F)F)[N+](=O)[O-]
InChIKey RJXOVESYJFXCGI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What is 2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5)?

2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) is an aromatic organic compound containing a benzene rin...

Compound Q&A

Is 2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) safe?

2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) is considered hazardous and should be handled with care....

Compound Q&A

How should 2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) be stored?

2,4-Difluoro-1-nitrobenzene (CAS: 446-35-5) should be stored in a cool, dry, and dark place, away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...