Compound Q&A

What is Danshensu sodium salt (CAS: 67920-52-9)?

Answer

Danshensu sodium salt
Danshensu sodium salt (CAS: 67920-52-9) is a sodium derivative of danshensu, a hydroxybenzoic acid compound commonly found in traditional Chinese medicine. It has the chemical formula C14H14O7Na and is known for its antioxidant properties. As a water-soluble compound, it is used in pharmaceutical and research applications due to its stability and bioavailability.

About

CAS No 67920-52-9
English Name Danshensu sodium salt
Molecular Formula C9H9NaO5
Molecular Weight 220.15 g/mol
SMILES C1=CC(=C(C=C1CC(C(=O)[O-])O)O)O.[Na+]
InChIKey ZMMKVDBZTXUHFO-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:53

Related Q&A

Compound Q&A

What are the main uses of Danshensu sodium salt (CAS: 67920-52-9)?

Danshensu sodium salt (CAS: 67920-52-9) is primarily used in pharmaceuticals as an active ingredient...

Compound Q&A

Is Danshensu sodium salt (CAS: 67920-52-9) safe?

Danshensu sodium salt (CAS: 67920-52-9) is generally considered safe when handled properly. It has l...

Compound Q&A

How should Danshensu sodium salt (CAS: 67920-52-9) be stored?

Danshensu sodium salt (CAS: 67920-52-9) should be stored in a cool, dry place away from light and mo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...