Compound Q&A

What is 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1)?

Answer

3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid
3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) is a chemical compound with the formula C16H17NO5S. It is a benzoic acid derivative featuring a butylamino group, phenoxy substituent, and sulfamoyl functionality. The compound is typically solid at room temperature and exhibits moderate solubility in polar solvents. Its structure combines aromatic rings with amino and sulfonamide groups, making it relevant in pharmaceutical and research contexts.

About

CAS No 28395-03-1
English Name 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid
Molecular Formula C17H20N2O5S
Molecular Weight 364.42 g/mol
SMILES CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2
InChIKey MAEIEVLCKWDQJH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1)?

3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) is primarily used in pharmaceutic...

Compound Q&A

Is 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) safe?

Safety of 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) depends on exposure con...

Compound Q&A

How should 3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) be stored?

3-(Butylamino)-4-phenoxy-5-sulfamoylbenzoic acid (CAS: 28395-03-1) should be stored in a cool, dry p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...