Compound Q&A

What are the main uses of Cobalt(2+) bis(2-ethylhexanoate) (CAS: 136-52-7)?

Answer

Cobalt(2+) bis(2-ethylhexanoate)
Cobalt(2+) bis(2-ethylhexanoate) is widely utilized in catalytic applications, particularly in the synthesis of pharmaceuticals and fine chemicals. It also finds use in industrial processes, such as polymerization reactions, and is employed in research for its role in coordination chemistry and as a precursor for other cobalt-based compounds.

About

CAS No 136-52-7
English Name Cobalt(2+) bis(2-ethylhexanoate)
Molecular Formula C16H30CoO4
Molecular Weight 345.34 g/mol
SMILES CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Co+2]
InChIKey QAEKNCDIHIGLFI-UHFFFAOYSA-L
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Cobalt(2+) bis(2-ethylhexanoate) (CAS: 136-52-7)?

Cobalt(2+) bis(2-ethylhexanoate) is a coordination compound with the CAS number 136-52-7. It consist...

Compound Q&A

Is Cobalt(2+) bis(2-ethylhexanoate) (CAS: 136-52-7) safe?

Cobalt(2+) bis(2-ethylhexanoate) is generally considered safe when handled properly. However, it sho...

Compound Q&A

How should Cobalt(2+) bis(2-ethylhexanoate) (CAS: 136-52-7) be stored?

Cobalt(2+) bis(2-ethylhexanoate) should be stored in a cool, dry, and dark place to maintain its sta...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...