Compound Q&A

What is 4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9)?

Answer

4-(4-Phenylbutoxy)benzoic acid
4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) is an organic compound with the chemical formula C17H18O3. It features a benzoic acid backbone with a 4-phenylbutoxy substituent, making it a versatile intermediate in chemical synthesis. The compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents. Its unique structure contributes to applications in pharmaceuticals and materials science.

About

CAS No 30131-16-9
English Name 4-(4-Phenylbutoxy)benzoic acid
Molecular Formula C17H18O3
Molecular Weight 270.33 g/mol
SMILES c1ccc(cc1)CCCCOc2ccc(cc2)C(=O)O
InChIKey XWCWFMQMZZPALR-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9)?

4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) is primarily used in pharmaceuticals as a precursor...

Compound Q&A

Is 4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) safe?

4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) is generally safe when handled according to standar...

Compound Q&A

How should 4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) be stored?

4-(4-Phenylbutoxy)benzoic acid (CAS: 30131-16-9) should be stored in a cool, dry place, away from li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...