Compound Q&A

What are the main uses of Bis(2-methyl-2-propanyl) imidodicarbonate (CAS: 51779-32-9)?

Answer

Bis(2-methyl-2-propanyl) imidodicarbonate
Bis(2-methyl-2-propanyl) imidodicarbonate is primarily used in the pharmaceutical industry for the synthesis of drugs and as a building block in the creation of polyurethanes. It also finds applications in research for developing new materials and in industrial processes for producing coatings and adhesives. Its unique chemical structure makes it suitable for reactions involving cross-linking and molecular modification.

About

CAS No 51779-32-9
English Name Bis(2-methyl-2-propanyl) imidodicarbonate
Molecular Formula C10H19NO4
Molecular Weight 217.26 g/mol
SMILES CC(C)(C)OC(=O)NC(=O)OC(C)(C)C
InChIKey XCAQIUOFDMREBA-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Bis(2-methyl-2-propanyl) imidodicarbonate (CAS: 51779-32-9)?

Bis(2-methyl-2-propanyl) imidodicarbonate is a carbamate compound with the CAS number 51779-32-9. It...

Compound Q&A

Is Bis(2-methyl-2-propanyl) imidodicarbonate (CAS: 51779-32-9) safe?

Bis(2-methyl-2-propanyl) imidodicarbonate is generally considered safe when handled properly, but it...

Compound Q&A

How should Bis(2-methyl-2-propanyl) imidodicarbonate (CAS: 51779-32-9) be stored?

Bis(2-methyl-2-propanyl) imidodicarbonate should be stored in a cool, dry, and well-ventilated area,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...