Compound Q&A

What is 3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3)?

Answer

3-Chloro-2,4,5-trifluorobenzoic acid
3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) is an organic compound containing a benzene ring substituted with three fluorine atoms and one chlorine atom, along with a carboxylic acid group. Its chemical formula is C7H3ClF3O2. The compound is known for its strong electron-withdrawing properties due to the fluorine and chlorine substituents, which influence its reactivity and biological activity.

About

English Name 3-Chloro-2,4,5-trifluorobenzoic acid
Molecular Formula C7H2ClF3O2
Molecular Weight 210.54 g/mol
SMILES C1=C(C(=C(C(=C1F)F)Cl)F)C(=O)O
InChIKey KBESHLYCSZINAJ-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3)?

3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) is primarily used in pharmaceutical research...

Compound Q&A

Is 3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) safe?

3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) is considered hazardous and requires careful...

Compound Q&A

How should 3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) be stored?

3-Chloro-2,4,5-trifluorobenzoic acid (CAS: 101513-77-3) should be stored in a cool, dry, and dark pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...