Compound Q&A

How should Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) be stored?

Answer

Taurochenodeoxycholic acid sodium
Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) should be stored in a cool, dry place (20-25°C), away from light and moisture. Keep in sealed, airtight containers, preferably glass or plastic, to maintain stability. Avoid exposure to heat or humidity to prevent degradation, and store in a secure location to ensure chemical safety.

About

CAS No 6009-98-9
English Name Taurochenodeoxycholic acid sodium
Molecular Formula C26H44NNaO6S
Molecular Weight 521.69 g/mol
SMILES C[C@H](CCC(NCCS(=O)([O-])=O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C.[Na+]
InChIKey IYPNVUSIMGAJFC-ULWOGUKGSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Taurochenodeoxycholic acid sodium (CAS: 6009-98-9)?

Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) is a bile acid derivative with the chemical formu...

Compound Q&A

What are the main uses of Taurochenodeoxycholic acid sodium (CAS: 6009-98-9)?

Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) is primarily used in pharmaceuticals to dissolve ...

Compound Q&A

Is Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) safe?

Taurochenodeoxycholic acid sodium (CAS: 6009-98-9) is generally safe when used as directed, with low...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...