Compound Q&A

How should sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate (CAS: 20666-12-0) be stored?

Answer

sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate
Store sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate in a cool, dry place away from light. Keep it in a sealed container to prevent moisture absorption. Maintain storage conditions between 2-8°C to ensure stability. Avoid exposure to heat and humidity to prevent degradation or contamination.

About

CAS No 20666-12-0
English Name sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate
Molecular Formula C8H6N3NaO2
Molecular Weight 199.14 g/mol
SMILES C1=CC2=C(C(=C1)N)C(=O)N[N-]C2=O.[Na+]
InChIKey RVJVDCVIJCBUTH-UHFFFAOYSA-M
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate (CAS: 20666-12-0)?

Sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate is a phthalazine derivative with the chemical for...

Compound Q&A

What are the main uses of sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate (CAS: 20666-12-0)?

This compound is primarily used in pharmaceutical research as a precursor for synthesizing antihista...

Compound Q&A

Is sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate (CAS: 20666-12-0) safe?

Sodium 5-amino-4-oxo-3,4-dihydrophthalazin-1-olate is generally considered safe when handled properl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...