Compound Q&A

What is (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid (CAS: 510-30-5)?

Answer

(3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid
This compound is a triterpene saponin, specifically an oleanolic acid derivative, with the chemical formula C30H52O6. It features hydroxyl groups at the 3beta and 16alpha positions, contributing to its polar characteristics. Known for its natural occurrence in plants, it exhibits structural stability and is of interest in pharmaceutical and biochemical research due to its potential biological activities.

About

CAS No 510-30-5
English Name (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid
Molecular Formula C30H48O4
Molecular Weight 472.71 g/mol
SMILES CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)O)C)C(=O)O)C
InChIKey YKOPWPOFWMYZJZ-PRIAQAIDSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid (CAS: 510-30-5)?

This compound is primarily used in pharmaceutical research for its anti-inflammatory and antidiabeti...

Compound Q&A

Is (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid (CAS: 510-30-5) safe?

The safety of this compound is generally considered acceptable when handled properly. It has a low t...

Compound Q&A

How should (3beta,16alpha)-3,16-Dihydroxyolean-12-en-28-oic acid (CAS: 510-30-5) be stored?

Store this compound in a sealed, airtight container at room temperature (15-25°C) and low humidity (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...