Compound Q&A

What is 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7)?

Answer

2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)-
2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)-, with the CAS number 13114-27-7, is an organic compound containing a purine ring. It is a derivative of 2-methylbutenol and is known for its structural complexity, which makes it relevant in various chemical applications. The compound is typically used in specialized chemical research and has a molecular formula of C11H14N4O2.

About

CAS No 13114-27-7
English Name 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)-
Molecular Formula C10H13N5O
Molecular Weight 219.24 g/mol
SMILES CC(=CCNC1=NC=NC2=C1NC=N2)CO
InChIKey UZKQTCBAMSWPJD-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7)?

2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7) is primarily used in pharmaceutical...

Compound Q&A

Is 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7) safe?

The safety of 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7) depends on its handli...

Compound Q&A

How should 2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7) be stored?

2-Buten-1-ol, 2-methyl-4-(9H-purin-6-ylamino)- (CAS: 13114-27-7) should be stored in a cool, dry, an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...