Compound Q&A

How should 4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) be stored?

Answer

4-(2-Piperidinoethoxy)benzoic acid hydrochloride
4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) should be stored in a sealed container at room temperature (15-25°C), in a dry and cool environment. Protect from light and moisture to maintain stability. Store in a well-ventilated area and keep away from incompatible substances to prevent degradation.

About

CAS No 84449-80-9
English Name 4-(2-Piperidinoethoxy)benzoic acid hydrochloride
Molecular Formula C14H20ClNO3
Molecular Weight 285.77 g/mol
SMILES C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)O.Cl
InChIKey CMVTYSMYHSVDIU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9)?

4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) is a chemical compound with the f...

Compound Q&A

What are the main uses of 4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9)?

4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) is primarily used as a pharmaceut...

Compound Q&A

Is 4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) safe?

4-(2-Piperidinoethoxy)benzoic acid hydrochloride (CAS: 84449-80-9) is generally considered safe when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...