Compound Q&A

What is 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3)?

Answer

1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride
1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) is a piperazine derivative with a benzo[b]thiophen-4-yl group, commonly used in pharmaceutical research. It has a molecular formula of C13H16N2S·HCl and exhibits characteristics such as solubility in water and a white crystalline appearance. The compound is known for its potential applications in drug development due to its structural versatility.

About

English Name 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride
Molecular Formula C12H15ClN2S
Molecular Weight 254.79 g/mol
SMILES C1CN(CCN1)C2=C3C=CSC3=CC=C2.Cl
InChIKey XDUUWPNOUUQXBX-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3)?

1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) is primarily utilized in pharma...

Compound Q&A

Is 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) safe?

1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) is generally considered safe wh...

Compound Q&A

How should 1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) be stored?

1-(Benzo[b]thiophen-4-yl)piperazine hydrochloride (CAS: 913614-18-3) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...