Compound Q&A

What is (4-Chloro-2-methoxyphenyl)boronic acid (CAS: 762287-57-0)?

Answer

(4-Chloro-2-methoxyphenyl)boronic acid
(4-Chloro-2-methoxyphenyl)boronic acid is an organic compound with the chemical formula C8H9ClO2B. It is a white solid at room temperature and has a boronic acid functional group attached to a chloro- and methoxy-substituted phenyl ring. This compound is commonly used in chemical synthesis as a versatile building block in the development of pharmaceuticals and other organic products.

About

English Name (4-Chloro-2-methoxyphenyl)boronic acid
Molecular Formula C7H8BClO3
Molecular Weight 186.4 g/mol
SMILES B(C1=C(C=C(C=C1)Cl)OC)(O)O
InChIKey NZRRMTBNTSBIFH-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (4-Chloro-2-methoxyphenyl)boronic acid (CAS: 762287-57-0)?

(4-Chloro-2-methoxyphenyl)boronic acid is primarily used in pharmaceutical research for the synthesi...

Compound Q&A

Is (4-Chloro-2-methoxyphenyl)boronic acid (CAS: 762287-57-0) safe?

While (4-Chloro-2-methoxyphenyl)boronic acid is generally considered safe when handled properly, it ...

Compound Q&A

How should (4-Chloro-2-methoxyphenyl)boronic acid (CAS: 762287-57-0) be stored?

(4-Chloro-2-methoxyphenyl)boronic acid should be stored in a cool, dry, and well-ventilated place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...