Compound Q&A

What is 2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1)?

Answer

2-(Diethylamino)ethyl 4-aminobenzoate
2-(Diethylamino)ethyl 4-aminobenzoate, with CAS number 59-46-1, is a chemical compound commonly used in pharmaceutical and industrial applications. It has the molecular formula C13H21NO3 and is known for its amide structure, which contributes to its solubility and reactivity. The compound is typically a white to off-white solid at room temperature and is slightly soluble in water.

About

CAS No 59-46-1
English Name 2-(Diethylamino)ethyl 4-aminobenzoate
Molecular Formula C13H20N2O2
Molecular Weight 236.32 g/mol
SMILES CCN(CC)CCOC(=O)C1=CC=C(C=C1)N
InChIKey MFDFERRIHVXMIY-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1)?

2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1) is primarily used in the pharmaceutical industr...

Compound Q&A

Is 2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1) safe?

2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1) is generally considered safe when handled prope...

Compound Q&A

How should 2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1) be stored?

2-(Diethylamino)ethyl 4-aminobenzoate (CAS: 59-46-1) should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...