Compound Q&A

What are the main uses of Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2)?

Answer

Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine
Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) is primarily used in pharmaceutical research as a potential therapeutic agent and in molecular biology for studying RNA and DNA functions. It also serves as a precursor in the synthesis of nucleotide-based drugs and is utilized in biochemical assays to investigate enzyme activity and nucleotide analog behavior.

About

CAS No 7415-69-2
English Name Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine
Molecular Formula C10H13N5Na2O11P2
Molecular Weight 487.16 g/mol
SMILES C1=NC2=C(N1C3C(C(C(O3)COP(=O)([O-])OP(=O)(O)[O-])O)O)N=C(NC2=O)N.[Na+].[Na+]
InChIKey LTZCGDIGAHOTKN-LGVAUZIVSA-L
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2)?

Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) is a nucleotide deriv...

Compound Q&A

Is Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) safe?

Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) is generally consider...

Compound Q&A

How should Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) be stored?

Disodium 5'-O-{[(hydroxyphosphinato)oxy]phosphinato}guanosine (CAS: 7415-69-2) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...