Compound Q&A

What are the main uses of 1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1)?

Answer

1,2-Ethynediylbis(trimethylsilane)
1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1) is primarily used in pharmaceutical and polymer industries as a coupling reagent. It also finds applications in research for modifying organic molecules and in the production of specialty chemicals. Its unique properties make it valuable in synthetic pathways requiring silicon-based intermediates.

About

CAS No 14630-40-1
English Name 1,2-Ethynediylbis(trimethylsilane)
Molecular Formula C8H18Si2
Molecular Weight 88.23 g/mol
SMILES C[Si](C)(C)C#C[Si](C)(C)C
InChIKey ZDWYFWIBTZJGOR-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1)?

1,2-Ethynediylbis(trimethylsilane), with the CAS number 14630-40-1, is an organosilicon compound fea...

Compound Q&A

Is 1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1) safe?

1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1) is generally considered safe when handled prope...

Compound Q&A

How should 1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1) be stored?

1,2-Ethynediylbis(trimethylsilane) (CAS: 14630-40-1) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...