Compound Q&A

What is 2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4)?

Answer

2,6-Dichlorobenzoyl chloride
2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) is an organic compound with the chemical formula C7H4Cl2O. It is a chlorinated aromatic acyl chloride, known for its reactivity and use in chemical synthesis. This compound is typically a yellow liquid with a sharp odor and is soluble in organic solvents.

About

CAS No 4659-45-4
English Name 2,6-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=CC(=C(C(=C1)Cl)C(=O)Cl)Cl
InChIKey JBLIDPPHFGWTKU-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4)?

2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) is widely used in pharmaceuticals for the synthesis of...

Compound Q&A

Is 2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) safe?

2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) requires careful handling due to its potential toxicit...

Compound Q&A

How should 2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) be stored?

2,6-Dichlorobenzoyl chloride (CAS: 4659-45-4) should be stored in a cool, dry, and well-ventilated a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...