Compound Q&A

What are the main uses of (3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione (CAS: 2746-19-2)?

Answer

(3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione
This compound is primarily used in pharmaceutical research as a key intermediate in the synthesis of certain drugs. It also finds applications in industrial chemistry for producing specialty materials and in organic research for studying reaction mechanisms. Its unique structure makes it valuable for developing compounds with specific biological activities.

About

CAS No 2746-19-2
English Name (3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione
Molecular Formula C9H8O3
Molecular Weight 164.16 g/mol
SMILES O=C1OC([C@]2([H])[C@@](C3)([H])C=C[C@@]3([H])[C@@]21[H])=O
InChIKey KNDQHSIWLOJIGP-RNGGSSJXSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione (CAS: 2746-19-2)?

This compound is a synthetic organic molecule with the CAS number 2746-19-2. It features a tetrahydr...

Compound Q&A

Is (3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione (CAS: 2746-19-2) safe?

Safety of this compound depends on handling conditions. It is considered hazardous and requires prop...

Compound Q&A

How should (3aR,4R,7S,7aS)-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione (CAS: 2746-19-2) be stored?

This compound should be stored in a cool, dry place away from light. Maintain storage conditions bel...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...