Compound Q&A

What are the main uses of 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4)?

Answer

3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine
This compound is primarily used in pharmaceutical research as a potential lead molecule for drug development. It has been explored for its activity in targeting specific biological pathways, such as those involved in cancer treatment and neurological disorders. Its applications also extend to chemical synthesis and medicinal chemistry studies.

About

English Name 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine
Molecular Formula C22H22N6O
Molecular Weight 386.46 g/mol
SMILES Nc1ncnc2c1c(nn2[C@@H]1CCCNC1)c1ccc(cc1)Oc1ccccc1
InChIKey GPSQYTDPBDNDGI-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4)?

3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4) is a heteroc...

Compound Q&A

Is 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4) safe?

The safety of 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4...

Compound Q&A

How should 3-(4-phenoxyphenyl)-1-(3-piperidyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 1022150-12-4) be stored?

This compound should be stored in a cool, dry place away from light. It is typically kept in airtigh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...