Compound Q&A

What is 4-Bromo-2-fluorobiphenyl (CAS: 41604-19-7)?

Answer

4-Bromo-2-fluorobiphenyl
4-Bromo-2-fluorobiphenyl is an organic compound with the chemical formula C12H9BrF. It belongs to the class of biphenyl derivatives and is characterized by the presence of bromine and fluorine atoms on adjacent carbon positions in the biphenyl ring. This compound is typically a yellow solid with low solubility in water and is used in various chemical applications due to its unique electronic properties.

About

CAS No 41604-19-7
English Name 4-Bromo-2-fluorobiphenyl
Molecular Formula C12H8BrF
Molecular Weight 251.1 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)F
InChIKey HTRNHWBOBYFTQF-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 4-Bromo-2-fluorobiphenyl (CAS: 41604-19-7)?

4-Bromo-2-fluorobiphenyl is primarily used in pharmaceutical research as a building block for drug d...

Compound Q&A

Is 4-Bromo-2-fluorobiphenyl (CAS: 41604-19-7) safe?

4-Bromo-2-fluorobiphenyl is considered hazardous due to potential toxicity. It should be handled wit...

Compound Q&A

How should 4-Bromo-2-fluorobiphenyl (CAS: 41604-19-7) be stored?

4-Bromo-2-fluorobiphenyl should be stored in a cool, dry, and well-ventilated place, away from light...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...