Compound Q&A

What is Cyasterone (CAS: 17086-76-9)?

Answer

Cyasterone
Cyasterone is a natural compound with the chemical formula C20H26O4. It is a steroidal alkaloid known for its potential biological activities and is often studied in the field of pharmacology. Cyasterone exhibits various chemical properties, including solubility in organic solvents and a specific melting point, which contribute to its utility in scientific research and potential applications in medicine.

About

CAS No 17086-76-9
English Name Cyasterone
Molecular Formula C29H44O9
Molecular Weight 536.65 g/mol
SMILES CC1C(C(OC1=O)C)CC(C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)O)O)C)C)O)O)O
InChIKey BZWMGJMVOQFRLR-RXYAIQCUSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Cyasterone (CAS: 17086-76-9)?

Cyasterone is primarily used in pharmaceutical research for its potential therapeutic effects, inclu...

Compound Q&A

Is Cyasterone (CAS: 17086-76-9) safe?

Cyasterone is generally considered safe when handled properly, but it should be used with caution. S...

Compound Q&A

How should Cyasterone (CAS: 17086-76-9) be stored?

Cyasterone should be stored in a cool, dry, and dark place, ideally at temperatures below 25°C. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...