Compound Q&A

What are the main uses of (2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1) (CAS: 26921-17-5)?

Answer

(2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1)
This compound is primarily used in pharmaceutical research as a key intermediate for developing drugs targeting various therapeutic areas. It is also applied in organic synthesis and chemical research for its structural versatility and reactivity. Its unique functional groups make it valuable in creating molecules with specific biological activities.

About

CAS No 26921-17-5
English Name (2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1)
Molecular Formula C17H28N4O7S
Molecular Weight 432.5 g/mol
SMILES CC(C)(C)NC[C@H](O)COc1nsnc1N2CCOCC2.OC(=O)/C=C\C(=O)O
InChIKey WLRMANUAADYWEA-NWASOUNVSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What is (2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1) (CAS: 26921-17-5)?

This compound, with the CAS number 26921-17-5, is a complex organic molecule containing a morpholine...

Compound Q&A

Is (2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1) (CAS: 26921-17-5) safe?

The safety of this compound depends on its handling and application. It is generally considered safe...

Compound Q&A

How should (2S)-1-[(2-Methyl-2-propanyl)amino]-3-{[4-(4-morpholinyl)-1,2,5-thiadiazol-3-yl]oxy}-2-propanol (2Z)-2-butenedioate (1:1) (CAS: 26921-17-5) be stored?

This compound should be stored in a cool, dry, and dark place to maintain stability. It is recommend...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...