Compound Q&A

What is 2-Methoxy-5-nitrophenol (CAS: 636-93-1)?

Answer

2-Methoxy-5-nitrophenol
2-Methoxy-5-nitrophenol (CAS: 636-93-1) is an organic compound with the chemical formula C7H6O3. It is a yellow solid with a phenolic odor, known for its moderate solubility in water and organic solvents. The compound exhibits acidic properties due to the presence of the hydroxyl group and is commonly used in various chemical applications.

About

CAS No 636-93-1
English Name 2-Methoxy-5-nitrophenol
Molecular Formula C7H7NO4
Molecular Weight 169.13 g/mol
SMILES COC1=C(C=C(C=C1)[N+](=O)[O-])O
InChIKey KXKCTSZYNCDFFG-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 2-Methoxy-5-nitrophenol (CAS: 636-93-1)?

2-Methoxy-5-nitrophenol (CAS: 636-93-1) is primarily used in the synthesis of pharmaceuticals, parti...

Compound Q&A

Is 2-Methoxy-5-nitrophenol (CAS: 636-93-1) safe?

2-Methoxy-5-nitrophenol (CAS: 636-93-1) is considered toxic if ingested or inhaled in large quantiti...

Compound Q&A

How should 2-Methoxy-5-nitrophenol (CAS: 636-93-1) be stored?

2-Methoxy-5-nitrophenol (CAS: 636-93-1) should be stored in a cool, dry, and well-ventilated area, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...