Compound Q&A

What is Escin (CAS: 6805-41-0)?

Answer

Escin is a naturally occurring saponin compound derived from the horse chestnut tree (Aesculus hippocastanum). It has the chemical formula C46H76O23 and is known for its flavonoid structure. Escin exhibits anti-inflammatory, venotonic, and antioxidant properties, making it a valuable compound in various scientific and medicinal applications.

About

CAS No 6805-41-0

English Name Escin

Molecular Formula C33H52O4

Molecular Weight 512.7750000000004 g/mol

SMILES CC=C(C(=O)OC1CC2C(O)CC3(C(=CCC4C3(C)CCC3C4CCCC3(C)CO)C2CC1(C)C)C)C

InChIKey XAVPEFBKSWBXRZ-UHFFFAOYSA-N

Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of Escin (CAS: 6805-41-0)?

Escin is primarily used in pharmaceuticals for its ability to improve venous circulation and reduce ...

Compound Q&A

Is Escin (CAS: 6805-41-0) safe?

Escin is generally considered safe when used as directed, with low toxicity reported in most studies...

Compound Q&A

How should Escin (CAS: 6805-41-0) be stored?

Escin should be stored in a cool, dry, and dark place to maintain its stability and potency. It is b...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Escin (CAS: 6805-41-0)?

Answer

About

Related Q&A

What are the main uses of Escin (CAS: 6805-41-0)?

Is Escin (CAS: 6805-41-0) safe?

How should Escin (CAS: 6805-41-0) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

HuBeiXinKangYiYao Chemical Co Ltd

Xi'an Knockno Chemical Industry Co., Ltd.

Nanjing Chunqiu Bioculture Engineering Co., Ltd.

BaoJiRunYu Biotechnology Co Ltd

HuBeiShiShun Biotechnology Co Ltd

Shanghai Bohui Meike Chemical Technology Co., Ltd.