Compound Q&A

What is (1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol (CAS: 761423-87-4)?

Answer

(1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol
This compound is a derivative of D-glucitol, featuring a substituted benzothiophene ring. It has the chemical formula C22H24F2O5S and is known for its complex structure, which includes a fluorophenyl group and a benzothiophenylmethyl substituent. The compound is typically used in specialized chemical applications due to its unique functional groups and stereochemistry.

About

English Name (1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol
Molecular Formula C21H21FO5S
Molecular Weight 404.45900000000006 g/mol
SMILES C1=CC=C2C(=C1)C=C(S2)CC3=C(C=CC(=C3)C4C(C(C(C(O4)CO)O)O)O)F
InChIKey AHFWIQIYAXSLBA-RQXATKFSSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of (1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol (CAS: 761423-87-4)?

This compound is primarily used in pharmaceutical research for the development of drugs targeting sp...

Compound Q&A

Is (1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol (CAS: 761423-87-4) safe?

Safety data for this compound is limited, but it should be handled with care in laboratory settings....

Compound Q&A

How should (1S)-1,5-Anhydro-1-[3-(1-benzothiophen-2-ylmethyl)-4-fluorophenyl]-D-glucitol (CAS: 761423-87-4) be stored?

This compound should be stored in a cool, dry place away from light. It is recommended to keep it in...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...