Compound Q&A

What is 4-Chloro-2,3-dimethylpyridine 1-oxide (CAS: 59886-90-7)?

Answer

4-Chloro-2,3-dimethylpyridine 1-oxide
4-Chloro-2,3-dimethylpyridine 1-oxide is an organic compound with the chemical formula C8H9ClNO. It is a derivative of pyridine, featuring a chlorine atom at the 4-position and methyl groups at the 2 and 3-positions, along with an oxo group. This compound is known for its aromatic structure and is commonly used in chemical synthesis. Its molecular weight is approximately 165.6 g/mol, and it exhibits moderate solubility in polar solvents.

About

CAS No 59886-90-7
English Name 4-Chloro-2,3-dimethylpyridine 1-oxide
Molecular Formula C7H8ClNO
Molecular Weight 157.6 g/mol
SMILES CC1=C(C=C[N+](=C1C)[O-])Cl
InChIKey MCUYHRNUDDANSO-UHFFFAOYSA-N
Last Updated: 2025-08-28 11:52

Related Q&A

Compound Q&A

What are the main uses of 4-Chloro-2,3-dimethylpyridine 1-oxide (CAS: 59886-90-7)?

4-Chloro-2,3-dimethylpyridine 1-oxide is primarily used in pharmaceutical research as an intermediat...

Compound Q&A

Is 4-Chloro-2,3-dimethylpyridine 1-oxide (CAS: 59886-90-7) safe?

4-Chloro-2,3-dimethylpyridine 1-oxide is considered hazardous and should be handled with care. It ma...

Compound Q&A

How should 4-Chloro-2,3-dimethylpyridine 1-oxide (CAS: 59886-90-7) be stored?

4-Chloro-2,3-dimethylpyridine 1-oxide should be stored in a cool, dry, and well-ventilated area, awa...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...